C10H12BrN3O3S2 — CID 79095575
7-(5-bromothiophen-2-yl)sulfonyl-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 79095575) has the molecular formula C10H12BrN3O3S2 and a molecular weight of 366.26 g/mol. Its IUPAC name is 7-(5-bromothiophen-2-yl)sulfonyl-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | 7-(5-bromothiophen-2-yl)sulfonyl-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 79095575 |
| Molecular Formula | C10H12BrN3O3S2 |
| Molecular Weight | 366.26 g/mol |
| Exact Mass | 364.95 |
| IUPAC Name | 7-(5-bromothiophen-2-yl)sulfonyl-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | O=C1NCC2CN(S(=O)(=O)c3ccc(Br)s3)CCN12 |
| InChI | InChI=1S/C10H12BrN3O3S2/c11-8-1-2-9(18-8)19(16,17)13-3-4-14-7(6-13)5-12-10(14)15/h1-2,7H,3-6H2,(H,12,15) |
| InChIKey | XLOBCJXJCKVXAS-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.26 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |