C11H13ClN4O3S — CID 79096303
methyl 4-chloro-2-(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)-1,3-thiazole-5-carboxylate (PubChem CID 79096303) has the molecular formula C11H13ClN4O3S and a molecular weight of 316.77 g/mol. Its IUPAC name is methyl 4-chloro-2-(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 4-chloro-2-(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 79096303 |
| Molecular Formula | C11H13ClN4O3S |
| Molecular Weight | 316.77 g/mol |
| Exact Mass | 316.04 |
| IUPAC Name | methyl 4-chloro-2-(3-oxo-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-7-yl)-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(N2CCN3C(=O)NCC3C2)nc1Cl |
| InChI | InChI=1S/C11H13ClN4O3S/c1-19-9(17)7-8(12)14-11(20-7)15-2-3-16-6(5-15)4-13-10(16)18/h6H,2-5H2,1H3,(H,13,18) |
| InChIKey | UQOBYQDKGAGYHU-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.77 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |