C14H19N3O4 — CID 79096388
ethyl 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-6-oxo-1H-pyrimidine-5-carboxylate (PubChem CID 79096388) has the molecular formula C14H19N3O4 and a molecular weight of 293.32 g/mol. Its IUPAC name is ethyl 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-6-oxo-1H-pyrimidine-5-carboxylate.
| Compound Name | ethyl 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-6-oxo-1H-pyrimidine-5-carboxylate |
|---|---|
| PubChem CID | 79096388 |
| Molecular Formula | C14H19N3O4 |
| Molecular Weight | 293.32 g/mol |
| Exact Mass | 293.14 |
| IUPAC Name | ethyl 2-(3,4,6,7,8,8a-hexahydro-1H-pyrrolo[2,1-c][1,4]oxazin-3-yl)-6-oxo-1H-pyrimidine-5-carboxylate |
| SMILES | CCOC(=O)c1cnc(C2CN3CCCC3CO2)[nH]c1=O |
| InChI | InChI=1S/C14H19N3O4/c1-2-20-14(19)10-6-15-12(16-13(10)18)11-7-17-5-3-4-9(17)8-21-11/h6,9,11H,2-5,7-8H2,1H3,(H,15,16,18) |
| InChIKey | SCRIQWUSWFTMIM-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 84.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.32 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |