C15H19N3O2S — CID 79096592
7-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one (PubChem CID 79096592) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is 7-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one.
| Compound Name | 7-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
|---|---|
| PubChem CID | 79096592 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | 7-[[4-(4-hydroxybut-1-ynyl)thiophen-2-yl]methyl]-1,2,5,6,8,8a-hexahydroimidazo[1,5-a]pyrazin-3-one |
| SMILES | O=C1NCC2CN(Cc3cc(C#CCCO)cs3)CCN12 |
| InChI | InChI=1S/C15H19N3O2S/c19-6-2-1-3-12-7-14(21-11-12)10-17-4-5-18-13(9-17)8-16-15(18)20/h7,11,13,19H,2,4-6,8-10H2,(H,16,20) |
| InChIKey | FCPYLTRWEWVIJN-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|