About 4-[3-(1-amino-2-methylpropyl)pyrrol-1-yl]-2,2-dimethylbutanenitrile
4-[3-(1-amino-2-methylpropyl)pyrrol-1-yl]-2,2-dimethylbutanenitrile (PubChem CID 79097038) has the molecular formula C14H23N3
and a molecular weight of 233.36 g/mol. Its IUPAC name is 4-[3-(1-amino-2-methylpropyl)pyrrol-1-yl]-2,2-dimethylbutanenitrile.
Molecular Properties
| Compound Name | 4-[3-(1-amino-2-methylpropyl)pyrrol-1-yl]-2,2-dimethylbutanenitrile |
| PubChem CID | 79097038 |
| Molecular Formula | C14H23N3 |
| Molecular Weight | 233.36 g/mol |
| Exact Mass | 233.19 |
| IUPAC Name | 4-[3-(1-amino-2-methylpropyl)pyrrol-1-yl]-2,2-dimethylbutanenitrile |
| SMILES | CC(C)C(N)c1ccn(CCC(C)(C)C#N)c1 |
| InChI | InChI=1S/C14H23N3/c1-11(2)13(16)12-5-7-17(9-12)8-6-14(3,4)10-15/h5,7,9,11,13H,6,8,16H2,1-4H3 |
| InChIKey | QOVPGFAIOCUXDC-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 54.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.36 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[3-(1-amino-2-methylpropyl)pyrrol-1-yl]-2,2-dimethylbutanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[3-(1-amino-2-methylpropyl)pyrrol-1-yl]-2,2-dimethylbutanenitrile?
The IUPAC name of 4-[3-(1-amino-2-methylpropyl)pyrrol-1-yl]-2,2-dimethylbutanenitrile (CID 79097038) is 4-[3-(1-amino-2-methylpropyl)pyrrol-1-yl]-2,2-dimethylbutanenitrile.
What is the SMILES notation for 4-[3-(1-amino-2-methylpropyl)pyrrol-1-yl]-2,2-dimethylbutanenitrile?
The canonical SMILES for 4-[3-(1-amino-2-methylpropyl)pyrrol-1-yl]-2,2-dimethylbutanenitrile is CC(C)C(N)c1ccn(CCC(C)(C)C#N)c1.
What is the InChIKey of 4-[3-(1-amino-2-methylpropyl)pyrrol-1-yl]-2,2-dimethylbutanenitrile?
The InChIKey is QOVPGFAIOCUXDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3/c1-11(2)13(16)12-5-7-17(9-12)8-6-14(3,4)10-15/h5,7,9,11,13H,6,8,16H2,1-4H3.
What are the key properties of 4-[3-(1-amino-2-methylpropyl)pyrrol-1-yl]-2,2-dimethylbutanenitrile?
4-[3-(1-amino-2-methylpropyl)pyrrol-1-yl]-2,2-dimethylbutanenitrile has a molecular weight of 233.36 g/mol, XLogP of 3.08, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[3-(1-amino-2-methylpropyl)pyrrol-1-yl]-2,2-dimethylbutanenitrile is sourced from PubChem (CID 79097038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).