C12H19F3N2O — CID 79097281
2-methyl-1-[1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrol-3-yl]propan-1-amine (PubChem CID 79097281) has the molecular formula C12H19F3N2O and a molecular weight of 264.29 g/mol. Its IUPAC name is 2-methyl-1-[1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrol-3-yl]propan-1-amine.
| Compound Name | 2-methyl-1-[1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrol-3-yl]propan-1-amine |
|---|---|
| PubChem CID | 79097281 |
| Molecular Formula | C12H19F3N2O |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 2-methyl-1-[1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrol-3-yl]propan-1-amine |
| SMILES | CC(C)C(N)c1ccn(CCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H19F3N2O/c1-9(2)11(16)10-3-4-17(7-10)5-6-18-8-12(13,14)15/h3-4,7,9,11H,5-6,8,16H2,1-2H3 |
| InChIKey | ZMVFUJQCSZXRNW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|