C13H20F3NO2 — CID 79097521
2-methyl-1-[1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrol-3-yl]propan-1-ol (PubChem CID 79097521) has the molecular formula C13H20F3NO2 and a molecular weight of 279.30 g/mol. Its IUPAC name is 2-methyl-1-[1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrol-3-yl]propan-1-ol.
| Compound Name | 2-methyl-1-[1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrol-3-yl]propan-1-ol |
|---|---|
| PubChem CID | 79097521 |
| Molecular Formula | C13H20F3NO2 |
| Molecular Weight | 279.30 g/mol |
| Exact Mass | 279.14 |
| IUPAC Name | 2-methyl-1-[1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrol-3-yl]propan-1-ol |
| SMILES | CC(C)C(O)c1ccn(CCCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C13H20F3NO2/c1-10(2)12(18)11-4-6-17(8-11)5-3-7-19-9-13(14,15)16/h4,6,8,10,12,18H,3,5,7,9H2,1-2H3 |
| InChIKey | LYMBTLZYQFJRFY-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.30 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|