C13H16BrNOS — CID 79097594
1-[1-[(3-bromothiophen-2-yl)methyl]pyrrol-3-yl]-2-methylpropan-1-ol (PubChem CID 79097594) has the molecular formula C13H16BrNOS and a molecular weight of 314.25 g/mol. Its IUPAC name is 1-[1-[(3-bromothiophen-2-yl)methyl]pyrrol-3-yl]-2-methylpropan-1-ol.
| Compound Name | 1-[1-[(3-bromothiophen-2-yl)methyl]pyrrol-3-yl]-2-methylpropan-1-ol |
|---|---|
| PubChem CID | 79097594 |
| Molecular Formula | C13H16BrNOS |
| Molecular Weight | 314.25 g/mol |
| Exact Mass | 313.01 |
| IUPAC Name | 1-[1-[(3-bromothiophen-2-yl)methyl]pyrrol-3-yl]-2-methylpropan-1-ol |
| SMILES | CC(C)C(O)c1ccn(Cc2sccc2Br)c1 |
| InChI | InChI=1S/C13H16BrNOS/c1-9(2)13(16)10-3-5-15(7-10)8-12-11(14)4-6-17-12/h3-7,9,13,16H,8H2,1-2H3 |
| InChIKey | VXOCDUKGGBWDPU-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.25 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |