About 2-N-(2,2-difluoroethyl)pyrazine-2,6-diamine
2-N-(2,2-difluoroethyl)pyrazine-2,6-diamine (PubChem CID 79098168) has the molecular formula C6H8F2N4
and a molecular weight of 174.15 g/mol. Its IUPAC name is 2-N-(2,2-difluoroethyl)pyrazine-2,6-diamine.
Molecular Properties
| Compound Name | 2-N-(2,2-difluoroethyl)pyrazine-2,6-diamine |
| PubChem CID | 79098168 |
| Molecular Formula | C6H8F2N4 |
| Molecular Weight | 174.15 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 2-N-(2,2-difluoroethyl)pyrazine-2,6-diamine |
| SMILES | Nc1cncc(NCC(F)F)n1 |
| InChI | InChI=1S/C6H8F2N4/c7-4(8)1-11-6-3-10-2-5(9)12-6/h2-4H,1H2,(H3,9,11,12) |
| InChIKey | ZBAURQLSKUYOBY-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.15 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-N-(2,2-difluoroethyl)pyrazine-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-N-(2,2-difluoroethyl)pyrazine-2,6-diamine?
The IUPAC name of 2-N-(2,2-difluoroethyl)pyrazine-2,6-diamine (CID 79098168) is 2-N-(2,2-difluoroethyl)pyrazine-2,6-diamine.
What is the SMILES notation for 2-N-(2,2-difluoroethyl)pyrazine-2,6-diamine?
The canonical SMILES for 2-N-(2,2-difluoroethyl)pyrazine-2,6-diamine is Nc1cncc(NCC(F)F)n1.
What is the InChIKey of 2-N-(2,2-difluoroethyl)pyrazine-2,6-diamine?
The InChIKey is ZBAURQLSKUYOBY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8F2N4/c7-4(8)1-11-6-3-10-2-5(9)12-6/h2-4H,1H2,(H3,9,11,12).
What are the key properties of 2-N-(2,2-difluoroethyl)pyrazine-2,6-diamine?
2-N-(2,2-difluoroethyl)pyrazine-2,6-diamine has a molecular weight of 174.15 g/mol, XLogP of 0.74, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-N-(2,2-difluoroethyl)pyrazine-2,6-diamine is sourced from PubChem (CID 79098168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).