About 5-chloro-4-(2,2-difluoroethylamino)-1H-pyridazin-6-one
5-chloro-4-(2,2-difluoroethylamino)-1H-pyridazin-6-one (PubChem CID 79098505) has the molecular formula C6H6ClF2N3O
and a molecular weight of 209.58 g/mol. Its IUPAC name is 5-chloro-4-(2,2-difluoroethylamino)-1H-pyridazin-6-one.
Molecular Properties
| Compound Name | 5-chloro-4-(2,2-difluoroethylamino)-1H-pyridazin-6-one |
| PubChem CID | 79098505 |
| Molecular Formula | C6H6ClF2N3O |
| Molecular Weight | 209.58 g/mol |
| Exact Mass | 209.02 |
| IUPAC Name | 5-chloro-4-(2,2-difluoroethylamino)-1H-pyridazin-6-one |
| SMILES | O=c1[nH]ncc(NCC(F)F)c1Cl |
| InChI | InChI=1S/C6H6ClF2N3O/c7-5-3(10-2-4(8)9)1-11-12-6(5)13/h1,4H,2H2,(H2,10,12,13) |
| InChIKey | BDADLPXNCSRSFM-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 57.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.58 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-chloro-4-(2,2-difluoroethylamino)-1H-pyridazin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4-(2,2-difluoroethylamino)-1H-pyridazin-6-one?
The IUPAC name of 5-chloro-4-(2,2-difluoroethylamino)-1H-pyridazin-6-one (CID 79098505) is 5-chloro-4-(2,2-difluoroethylamino)-1H-pyridazin-6-one.
What is the SMILES notation for 5-chloro-4-(2,2-difluoroethylamino)-1H-pyridazin-6-one?
The canonical SMILES for 5-chloro-4-(2,2-difluoroethylamino)-1H-pyridazin-6-one is O=c1[nH]ncc(NCC(F)F)c1Cl.
What is the InChIKey of 5-chloro-4-(2,2-difluoroethylamino)-1H-pyridazin-6-one?
The InChIKey is BDADLPXNCSRSFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClF2N3O/c7-5-3(10-2-4(8)9)1-11-12-6(5)13/h1,4H,2H2,(H2,10,12,13).
What are the key properties of 5-chloro-4-(2,2-difluoroethylamino)-1H-pyridazin-6-one?
5-chloro-4-(2,2-difluoroethylamino)-1H-pyridazin-6-one has a molecular weight of 209.58 g/mol, XLogP of 1.10, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4-(2,2-difluoroethylamino)-1H-pyridazin-6-one is sourced from PubChem (CID 79098505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).