C5H6F2N4O2 — CID 79098619
6-(2,2-difluoroethylamino)-2H-1,2,4-triazine-3,5-dione (PubChem CID 79098619) has the molecular formula C5H6F2N4O2 and a molecular weight of 192.12 g/mol. Its IUPAC name is 6-(2,2-difluoroethylamino)-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-(2,2-difluoroethylamino)-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 79098619 |
| Molecular Formula | C5H6F2N4O2 |
| Molecular Weight | 192.12 g/mol |
| Exact Mass | 192.05 |
| IUPAC Name | 6-(2,2-difluoroethylamino)-2H-1,2,4-triazine-3,5-dione |
| SMILES | O=c1[nH]nc(NCC(F)F)c(=O)[nH]1 |
| InChI | InChI=1S/C5H6F2N4O2/c6-2(7)1-8-3-4(12)9-5(13)11-10-3/h2H,1H2,(H,8,10)(H2,9,11,12,13) |
| InChIKey | USXKAVOGYNHUNK-UHFFFAOYSA-N |
| XLogP | -0.86 |
| TPSA | 90.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.12 |
| LogP ≤ 5 | -0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |