About [1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-3-yl]-cyclopropylmethanamine
[1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-3-yl]-cyclopropylmethanamine (PubChem CID 79098652) has the molecular formula C16H23ClN4
and a molecular weight of 306.84 g/mol. Its IUPAC name is [1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-3-yl]-cyclopropylmethanamine.
Molecular Properties
| Compound Name | [1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-3-yl]-cyclopropylmethanamine |
| PubChem CID | 79098652 |
| Molecular Formula | C16H23ClN4 |
| Molecular Weight | 306.84 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | [1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-3-yl]-cyclopropylmethanamine |
| SMILES | CCc1nn(CC)c(Cn2ccc(C(N)C3CC3)c2)c1Cl |
| InChI | InChI=1S/C16H23ClN4/c1-3-13-15(17)14(21(4-2)19-13)10-20-8-7-12(9-20)16(18)11-5-6-11/h7-9,11,16H,3-6,10,18H2,1-2H3 |
| InChIKey | XCPPJAIXUWJLNC-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 48.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.84 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-3-yl]-cyclopropylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-3-yl]-cyclopropylmethanamine?
The IUPAC name of [1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-3-yl]-cyclopropylmethanamine (CID 79098652) is [1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-3-yl]-cyclopropylmethanamine.
What is the SMILES notation for [1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-3-yl]-cyclopropylmethanamine?
The canonical SMILES for [1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-3-yl]-cyclopropylmethanamine is CCc1nn(CC)c(Cn2ccc(C(N)C3CC3)c2)c1Cl.
What is the InChIKey of [1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-3-yl]-cyclopropylmethanamine?
The InChIKey is XCPPJAIXUWJLNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H23ClN4/c1-3-13-15(17)14(21(4-2)19-13)10-20-8-7-12(9-20)16(18)11-5-6-11/h7-9,11,16H,3-6,10,18H2,1-2H3.
What are the key properties of [1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-3-yl]-cyclopropylmethanamine?
[1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-3-yl]-cyclopropylmethanamine has a molecular weight of 306.84 g/mol, XLogP of 3.38, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-3-yl]-cyclopropylmethanamine is sourced from PubChem (CID 79098652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).