C15H16FN3 — CID 79099324
4-fluoro-3-[[3-[1-(methylamino)ethyl]pyrrol-1-yl]methyl]benzonitrile (PubChem CID 79099324) has the molecular formula C15H16FN3 and a molecular weight of 257.31 g/mol. Its IUPAC name is 4-fluoro-3-[[3-[1-(methylamino)ethyl]pyrrol-1-yl]methyl]benzonitrile.
| Compound Name | 4-fluoro-3-[[3-[1-(methylamino)ethyl]pyrrol-1-yl]methyl]benzonitrile |
|---|---|
| PubChem CID | 79099324 |
| Molecular Formula | C15H16FN3 |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 4-fluoro-3-[[3-[1-(methylamino)ethyl]pyrrol-1-yl]methyl]benzonitrile |
| SMILES | CNC(C)c1ccn(Cc2cc(C#N)ccc2F)c1 |
| InChI | InChI=1S/C15H16FN3/c1-11(18-2)13-5-6-19(9-13)10-14-7-12(8-17)3-4-15(14)16/h3-7,9,11,18H,10H2,1-2H3 |
| InChIKey | KKRGRRLUPILPHR-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 40.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |