C15H18BrN3O — CID 79099508
N-(4-bromophenyl)-2-[3-[1-(methylamino)ethyl]pyrrol-1-yl]acetamide (PubChem CID 79099508) has the molecular formula C15H18BrN3O and a molecular weight of 336.23 g/mol. Its IUPAC name is N-(4-bromophenyl)-2-[3-[1-(methylamino)ethyl]pyrrol-1-yl]acetamide.
| Compound Name | N-(4-bromophenyl)-2-[3-[1-(methylamino)ethyl]pyrrol-1-yl]acetamide |
|---|---|
| PubChem CID | 79099508 |
| Molecular Formula | C15H18BrN3O |
| Molecular Weight | 336.23 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | N-(4-bromophenyl)-2-[3-[1-(methylamino)ethyl]pyrrol-1-yl]acetamide |
| SMILES | CNC(C)c1ccn(CC(=O)Nc2ccc(Br)cc2)c1 |
| InChI | InChI=1S/C15H18BrN3O/c1-11(17-2)12-7-8-19(9-12)10-15(20)18-14-5-3-13(16)4-6-14/h3-9,11,17H,10H2,1-2H3,(H,18,20) |
| InChIKey | IZJJEBOKSNXLEP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.23 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |