C10H15N3 — CID 79099547
2-[3-[1-(ethylamino)ethyl]pyrrol-1-yl]acetonitrile (PubChem CID 79099547) has the molecular formula C10H15N3 and a molecular weight of 177.25 g/mol. Its IUPAC name is 2-[3-[1-(ethylamino)ethyl]pyrrol-1-yl]acetonitrile.
| Compound Name | 2-[3-[1-(ethylamino)ethyl]pyrrol-1-yl]acetonitrile |
|---|---|
| PubChem CID | 79099547 |
| Molecular Formula | C10H15N3 |
| Molecular Weight | 177.25 g/mol |
| Exact Mass | 177.13 |
| IUPAC Name | 2-[3-[1-(ethylamino)ethyl]pyrrol-1-yl]acetonitrile |
| SMILES | CCNC(C)c1ccn(CC#N)c1 |
| InChI | InChI=1S/C10H15N3/c1-3-12-9(2)10-4-6-13(8-10)7-5-11/h4,6,8-9,12H,3,7H2,1-2H3 |
| InChIKey | LKVXCYUFOTZFNT-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 40.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.25 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |