C14H23F3N2O — CID 79099551
N-[1-[1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrol-3-yl]ethyl]propan-1-amine (PubChem CID 79099551) has the molecular formula C14H23F3N2O and a molecular weight of 292.35 g/mol. Its IUPAC name is N-[1-[1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrol-3-yl]ethyl]propan-1-amine.
| Compound Name | N-[1-[1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrol-3-yl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 79099551 |
| Molecular Formula | C14H23F3N2O |
| Molecular Weight | 292.35 g/mol |
| Exact Mass | 292.18 |
| IUPAC Name | N-[1-[1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrol-3-yl]ethyl]propan-1-amine |
| SMILES | CCCNC(C)c1ccn(CCCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C14H23F3N2O/c1-3-6-18-12(2)13-5-8-19(10-13)7-4-9-20-11-14(15,16)17/h5,8,10,12,18H,3-4,6-7,9,11H2,1-2H3 |
| InChIKey | FGBRTZVYOASWBH-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.35 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|