About 6-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]pyridazine-3-carboxamide
6-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]pyridazine-3-carboxamide (PubChem CID 79099798) has the molecular formula C11H13N5OS
and a molecular weight of 263.33 g/mol. Its IUPAC name is 6-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]pyridazine-3-carboxamide.
Molecular Properties
| Compound Name | 6-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]pyridazine-3-carboxamide |
| PubChem CID | 79099798 |
| Molecular Formula | C11H13N5OS |
| Molecular Weight | 263.33 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 6-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]pyridazine-3-carboxamide |
| SMILES | Cc1csc(C(C)Nc2ccc(C(N)=O)nn2)n1 |
| InChI | InChI=1S/C11H13N5OS/c1-6-5-18-11(13-6)7(2)14-9-4-3-8(10(12)17)15-16-9/h3-5,7H,1-2H3,(H2,12,17)(H,14,16) |
| InChIKey | RMWOBRXFQRXSSN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]pyridazine-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]pyridazine-3-carboxamide?
The IUPAC name of 6-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]pyridazine-3-carboxamide (CID 79099798) is 6-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]pyridazine-3-carboxamide.
What is the SMILES notation for 6-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]pyridazine-3-carboxamide?
The canonical SMILES for 6-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]pyridazine-3-carboxamide is Cc1csc(C(C)Nc2ccc(C(N)=O)nn2)n1.
What is the InChIKey of 6-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]pyridazine-3-carboxamide?
The InChIKey is RMWOBRXFQRXSSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N5OS/c1-6-5-18-11(13-6)7(2)14-9-4-3-8(10(12)17)15-16-9/h3-5,7H,1-2H3,(H2,12,17)(H,14,16).
What are the key properties of 6-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]pyridazine-3-carboxamide?
6-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]pyridazine-3-carboxamide has a molecular weight of 263.33 g/mol, XLogP of 1.51, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[1-(4-methyl-1,3-thiazol-2-yl)ethylamino]pyridazine-3-carboxamide is sourced from PubChem (CID 79099798), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).