C14H16FN3O — CID 79099918
3-[[(2,5-dimethylpyrrol-1-yl)amino]methyl]-4-fluorobenzamide (PubChem CID 79099918) has the molecular formula C14H16FN3O and a molecular weight of 261.30 g/mol. Its IUPAC name is 3-[[(2,5-dimethylpyrrol-1-yl)amino]methyl]-4-fluorobenzamide.
| Compound Name | 3-[[(2,5-dimethylpyrrol-1-yl)amino]methyl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 79099918 |
| Molecular Formula | C14H16FN3O |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | 3-[[(2,5-dimethylpyrrol-1-yl)amino]methyl]-4-fluorobenzamide |
| SMILES | Cc1ccc(C)n1NCc1cc(C(N)=O)ccc1F |
| InChI | InChI=1S/C14H16FN3O/c1-9-3-4-10(2)18(9)17-8-12-7-11(14(16)19)5-6-13(12)15/h3-7,17H,8H2,1-2H3,(H2,16,19) |
| InChIKey | VXOAEXKITIBVQY-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |