C12H20N2O — CID 79100005
2-[(2,5-dimethylpyrrol-1-yl)amino]cyclohexan-1-ol (PubChem CID 79100005) has the molecular formula C12H20N2O and a molecular weight of 208.31 g/mol. Its IUPAC name is 2-[(2,5-dimethylpyrrol-1-yl)amino]cyclohexan-1-ol.
| Compound Name | 2-[(2,5-dimethylpyrrol-1-yl)amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 79100005 |
| Molecular Formula | C12H20N2O |
| Molecular Weight | 208.31 g/mol |
| Exact Mass | 208.16 |
| IUPAC Name | 2-[(2,5-dimethylpyrrol-1-yl)amino]cyclohexan-1-ol |
| SMILES | Cc1ccc(C)n1NC1CCCCC1O |
| InChI | InChI=1S/C12H20N2O/c1-9-7-8-10(2)14(9)13-11-5-3-4-6-12(11)15/h7-8,11-13,15H,3-6H2,1-2H3 |
| InChIKey | MJODPAJACSDDIC-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 37.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.31 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |