About N-[(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine
N-[(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine (PubChem CID 79100045) has the molecular formula C13H15FN2
and a molecular weight of 218.28 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine.
Molecular Properties
| Compound Name | N-[(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine |
| PubChem CID | 79100045 |
| Molecular Formula | C13H15FN2 |
| Molecular Weight | 218.28 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine |
| SMILES | Cc1ccc(C)n1NCc1ccc(F)cc1 |
| InChI | InChI=1S/C13H15FN2/c1-10-3-4-11(2)16(10)15-9-12-5-7-13(14)8-6-12/h3-8,15H,9H2,1-2H3 |
| InChIKey | ZQENUXYYTHIHOY-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.28 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine?
The IUPAC name of N-[(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine (CID 79100045) is N-[(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine.
What is the SMILES notation for N-[(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine?
The canonical SMILES for N-[(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine is Cc1ccc(C)n1NCc1ccc(F)cc1.
What is the InChIKey of N-[(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine?
The InChIKey is ZQENUXYYTHIHOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15FN2/c1-10-3-4-11(2)16(10)15-9-12-5-7-13(14)8-6-12/h3-8,15H,9H2,1-2H3.
What are the key properties of N-[(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine?
N-[(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine has a molecular weight of 218.28 g/mol, XLogP of 2.99, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-fluorophenyl)methyl]-2,5-dimethylpyrrol-1-amine is sourced from PubChem (CID 79100045), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).