About N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,5-dimethylpyrrol-1-amine
N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,5-dimethylpyrrol-1-amine (PubChem CID 79100157) has the molecular formula C14H22N2O2
and a molecular weight of 250.34 g/mol. Its IUPAC name is N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,5-dimethylpyrrol-1-amine.
Molecular Properties
| Compound Name | N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,5-dimethylpyrrol-1-amine |
| PubChem CID | 79100157 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,5-dimethylpyrrol-1-amine |
| SMILES | Cc1ccc(C)n1NC1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C14H22N2O2/c1-11-3-4-12(2)16(11)15-13-5-7-14(8-6-13)17-9-10-18-14/h3-4,13,15H,5-10H2,1-2H3 |
| InChIKey | JIEXMPZTKNMZJV-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 35.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,5-dimethylpyrrol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,5-dimethylpyrrol-1-amine?
The IUPAC name of N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,5-dimethylpyrrol-1-amine (CID 79100157) is N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,5-dimethylpyrrol-1-amine.
What is the SMILES notation for N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,5-dimethylpyrrol-1-amine?
The canonical SMILES for N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,5-dimethylpyrrol-1-amine is Cc1ccc(C)n1NC1CCC2(CC1)OCCO2.
What is the InChIKey of N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,5-dimethylpyrrol-1-amine?
The InChIKey is JIEXMPZTKNMZJV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H22N2O2/c1-11-3-4-12(2)16(11)15-13-5-7-14(8-6-13)17-9-10-18-14/h3-4,13,15H,5-10H2,1-2H3.
What are the key properties of N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,5-dimethylpyrrol-1-amine?
N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,5-dimethylpyrrol-1-amine has a molecular weight of 250.34 g/mol, XLogP of 2.33, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(1,4-dioxaspiro[4.5]decan-8-yl)-2,5-dimethylpyrrol-1-amine is sourced from PubChem (CID 79100157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).