About N-ethyl-2,5-dimethylpyrrol-1-amine
N-ethyl-2,5-dimethylpyrrol-1-amine (PubChem CID 79100158) has the molecular formula C8H14N2
and a molecular weight of 138.21 g/mol. Its IUPAC name is N-ethyl-2,5-dimethylpyrrol-1-amine.
Molecular Properties
| Compound Name | N-ethyl-2,5-dimethylpyrrol-1-amine |
| PubChem CID | 79100158 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | N-ethyl-2,5-dimethylpyrrol-1-amine |
| SMILES | CCNn1c(C)ccc1C |
| InChI | InChI=1S/C8H14N2/c1-4-9-10-7(2)5-6-8(10)3/h5-6,9H,4H2,1-3H3 |
| InChIKey | AGZWPMQAWLFAJU-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-ethyl-2,5-dimethylpyrrol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,5-dimethylpyrrol-1-amine?
The IUPAC name of N-ethyl-2,5-dimethylpyrrol-1-amine (CID 79100158) is N-ethyl-2,5-dimethylpyrrol-1-amine.
What is the SMILES notation for N-ethyl-2,5-dimethylpyrrol-1-amine?
The canonical SMILES for N-ethyl-2,5-dimethylpyrrol-1-amine is CCNn1c(C)ccc1C.
What is the InChIKey of N-ethyl-2,5-dimethylpyrrol-1-amine?
The InChIKey is AGZWPMQAWLFAJU-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N2/c1-4-9-10-7(2)5-6-8(10)3/h5-6,9H,4H2,1-3H3.
What are the key properties of N-ethyl-2,5-dimethylpyrrol-1-amine?
N-ethyl-2,5-dimethylpyrrol-1-amine has a molecular weight of 138.21 g/mol, XLogP of 1.67, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,5-dimethylpyrrol-1-amine is sourced from PubChem (CID 79100158), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).