About N-hexyl-2,5-dimethylpyrrol-1-amine
N-hexyl-2,5-dimethylpyrrol-1-amine (PubChem CID 79101002) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is N-hexyl-2,5-dimethylpyrrol-1-amine.
Molecular Properties
| Compound Name | N-hexyl-2,5-dimethylpyrrol-1-amine |
| PubChem CID | 79101002 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | N-hexyl-2,5-dimethylpyrrol-1-amine |
| SMILES | CCCCCCNn1c(C)ccc1C |
| InChI | InChI=1S/C12H22N2/c1-4-5-6-7-10-13-14-11(2)8-9-12(14)3/h8-9,13H,4-7,10H2,1-3H3 |
| InChIKey | AQVQNSDIAULLQM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-hexyl-2,5-dimethylpyrrol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hexyl-2,5-dimethylpyrrol-1-amine?
The IUPAC name of N-hexyl-2,5-dimethylpyrrol-1-amine (CID 79101002) is N-hexyl-2,5-dimethylpyrrol-1-amine.
What is the SMILES notation for N-hexyl-2,5-dimethylpyrrol-1-amine?
The canonical SMILES for N-hexyl-2,5-dimethylpyrrol-1-amine is CCCCCCNn1c(C)ccc1C.
What is the InChIKey of N-hexyl-2,5-dimethylpyrrol-1-amine?
The InChIKey is AQVQNSDIAULLQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2/c1-4-5-6-7-10-13-14-11(2)8-9-12(14)3/h8-9,13H,4-7,10H2,1-3H3.
What are the key properties of N-hexyl-2,5-dimethylpyrrol-1-amine?
N-hexyl-2,5-dimethylpyrrol-1-amine has a molecular weight of 194.32 g/mol, XLogP of 3.23, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-hexyl-2,5-dimethylpyrrol-1-amine is sourced from PubChem (CID 79101002), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).