About 2,5-dimethyl-N-(1,3-oxazol-5-ylmethyl)pyrrol-1-amine
2,5-dimethyl-N-(1,3-oxazol-5-ylmethyl)pyrrol-1-amine (PubChem CID 79101202) has the molecular formula C10H13N3O
and a molecular weight of 191.23 g/mol. Its IUPAC name is 2,5-dimethyl-N-(1,3-oxazol-5-ylmethyl)pyrrol-1-amine.
Molecular Properties
| Compound Name | 2,5-dimethyl-N-(1,3-oxazol-5-ylmethyl)pyrrol-1-amine |
| PubChem CID | 79101202 |
| Molecular Formula | C10H13N3O |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.11 |
| IUPAC Name | 2,5-dimethyl-N-(1,3-oxazol-5-ylmethyl)pyrrol-1-amine |
| SMILES | Cc1ccc(C)n1NCc1cnco1 |
| InChI | InChI=1S/C10H13N3O/c1-8-3-4-9(2)13(8)12-6-10-5-11-7-14-10/h3-5,7,12H,6H2,1-2H3 |
| InChIKey | SPARQAGAXSTEDN-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 42.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,5-dimethyl-N-(1,3-oxazol-5-ylmethyl)pyrrol-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-dimethyl-N-(1,3-oxazol-5-ylmethyl)pyrrol-1-amine?
The IUPAC name of 2,5-dimethyl-N-(1,3-oxazol-5-ylmethyl)pyrrol-1-amine (CID 79101202) is 2,5-dimethyl-N-(1,3-oxazol-5-ylmethyl)pyrrol-1-amine.
What is the SMILES notation for 2,5-dimethyl-N-(1,3-oxazol-5-ylmethyl)pyrrol-1-amine?
The canonical SMILES for 2,5-dimethyl-N-(1,3-oxazol-5-ylmethyl)pyrrol-1-amine is Cc1ccc(C)n1NCc1cnco1.
What is the InChIKey of 2,5-dimethyl-N-(1,3-oxazol-5-ylmethyl)pyrrol-1-amine?
The InChIKey is SPARQAGAXSTEDN-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N3O/c1-8-3-4-9(2)13(8)12-6-10-5-11-7-14-10/h3-5,7,12H,6H2,1-2H3.
What are the key properties of 2,5-dimethyl-N-(1,3-oxazol-5-ylmethyl)pyrrol-1-amine?
2,5-dimethyl-N-(1,3-oxazol-5-ylmethyl)pyrrol-1-amine has a molecular weight of 191.23 g/mol, XLogP of 1.84, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-dimethyl-N-(1,3-oxazol-5-ylmethyl)pyrrol-1-amine is sourced from PubChem (CID 79101202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).