C11H15NO3 — CID 79104228
1-(oxan-4-ylmethyl)pyrrole-3-carboxylic acid (PubChem CID 79104228) has the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. Its IUPAC name is 1-(oxan-4-ylmethyl)pyrrole-3-carboxylic acid.
| Compound Name | 1-(oxan-4-ylmethyl)pyrrole-3-carboxylic acid |
|---|---|
| PubChem CID | 79104228 |
| Molecular Formula | C11H15NO3 |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.11 |
| IUPAC Name | 1-(oxan-4-ylmethyl)pyrrole-3-carboxylic acid |
| SMILES | O=C(O)c1ccn(CC2CCOCC2)c1 |
| InChI | InChI=1S/C11H15NO3/c13-11(14)10-1-4-12(8-10)7-9-2-5-15-6-3-9/h1,4,8-9H,2-3,5-7H2,(H,13,14) |
| InChIKey | CWLYEPQSFCIYSV-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |