C14H16Cl2N2 — CID 79104615
1-[1-[(2,5-dichlorophenyl)methyl]pyrrol-3-yl]propan-1-amine (PubChem CID 79104615) has the molecular formula C14H16Cl2N2 and a molecular weight of 283.20 g/mol. Its IUPAC name is 1-[1-[(2,5-dichlorophenyl)methyl]pyrrol-3-yl]propan-1-amine.
| Compound Name | 1-[1-[(2,5-dichlorophenyl)methyl]pyrrol-3-yl]propan-1-amine |
|---|---|
| PubChem CID | 79104615 |
| Molecular Formula | C14H16Cl2N2 |
| Molecular Weight | 283.20 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 1-[1-[(2,5-dichlorophenyl)methyl]pyrrol-3-yl]propan-1-amine |
| SMILES | CCC(N)c1ccn(Cc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C14H16Cl2N2/c1-2-14(17)10-5-6-18(8-10)9-11-7-12(15)3-4-13(11)16/h3-8,14H,2,9,17H2,1H3 |
| InChIKey | BVUBOIGZZGMDKM-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 30.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.20 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |