C16H31N3 — CID 79104740
1-[1-[2-(diethylamino)ethyl]pyrrol-3-yl]-N-propylpropan-1-amine (PubChem CID 79104740) has the molecular formula C16H31N3 and a molecular weight of 265.44 g/mol. Its IUPAC name is 1-[1-[2-(diethylamino)ethyl]pyrrol-3-yl]-N-propylpropan-1-amine.
| Compound Name | 1-[1-[2-(diethylamino)ethyl]pyrrol-3-yl]-N-propylpropan-1-amine |
|---|---|
| PubChem CID | 79104740 |
| Molecular Formula | C16H31N3 |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.25 |
| IUPAC Name | 1-[1-[2-(diethylamino)ethyl]pyrrol-3-yl]-N-propylpropan-1-amine |
| SMILES | CCCNC(CC)c1ccn(CCN(CC)CC)c1 |
| InChI | InChI=1S/C16H31N3/c1-5-10-17-16(6-2)15-9-11-19(14-15)13-12-18(7-3)8-4/h9,11,14,16-17H,5-8,10,12-13H2,1-4H3 |
| InChIKey | RFHANHKYSVAMRQ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |