C14H17NOS — CID 79105630
1-[1-(2-thiophen-2-ylethyl)pyrrol-3-yl]butan-1-one (PubChem CID 79105630) has the molecular formula C14H17NOS and a molecular weight of 247.36 g/mol. Its IUPAC name is 1-[1-(2-thiophen-2-ylethyl)pyrrol-3-yl]butan-1-one.
| Compound Name | 1-[1-(2-thiophen-2-ylethyl)pyrrol-3-yl]butan-1-one |
|---|---|
| PubChem CID | 79105630 |
| Molecular Formula | C14H17NOS |
| Molecular Weight | 247.36 g/mol |
| Exact Mass | 247.10 |
| IUPAC Name | 1-[1-(2-thiophen-2-ylethyl)pyrrol-3-yl]butan-1-one |
| SMILES | CCCC(=O)c1ccn(CCc2cccs2)c1 |
| InChI | InChI=1S/C14H17NOS/c1-2-4-14(16)12-6-8-15(11-12)9-7-13-5-3-10-17-13/h3,5-6,8,10-11H,2,4,7,9H2,1H3 |
| InChIKey | WGTBDEQBTHQBJQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |