C12H19F3N2O — CID 79105934
1-[1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrol-3-yl]propan-1-amine (PubChem CID 79105934) has the molecular formula C12H19F3N2O and a molecular weight of 264.29 g/mol. Its IUPAC name is 1-[1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrol-3-yl]propan-1-amine.
| Compound Name | 1-[1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrol-3-yl]propan-1-amine |
|---|---|
| PubChem CID | 79105934 |
| Molecular Formula | C12H19F3N2O |
| Molecular Weight | 264.29 g/mol |
| Exact Mass | 264.14 |
| IUPAC Name | 1-[1-[3-(2,2,2-trifluoroethoxy)propyl]pyrrol-3-yl]propan-1-amine |
| SMILES | CCC(N)c1ccn(CCCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C12H19F3N2O/c1-2-11(16)10-4-6-17(8-10)5-3-7-18-9-12(13,14)15/h4,6,8,11H,2-3,5,7,9,16H2,1H3 |
| InChIKey | DUYRVSRZVUMJIQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 40.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|