C15H24N4 — CID 79105948
1-[1-[(1-butan-2-ylpyrazol-3-yl)methyl]pyrrol-3-yl]propan-1-amine (PubChem CID 79105948) has the molecular formula C15H24N4 and a molecular weight of 260.38 g/mol. Its IUPAC name is 1-[1-[(1-butan-2-ylpyrazol-3-yl)methyl]pyrrol-3-yl]propan-1-amine.
| Compound Name | 1-[1-[(1-butan-2-ylpyrazol-3-yl)methyl]pyrrol-3-yl]propan-1-amine |
|---|---|
| PubChem CID | 79105948 |
| Molecular Formula | C15H24N4 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.20 |
| IUPAC Name | 1-[1-[(1-butan-2-ylpyrazol-3-yl)methyl]pyrrol-3-yl]propan-1-amine |
| SMILES | CCC(N)c1ccn(Cc2ccn(C(C)CC)n2)c1 |
| InChI | InChI=1S/C15H24N4/c1-4-12(3)19-9-7-14(17-19)11-18-8-6-13(10-18)15(16)5-2/h6-10,12,15H,4-5,11,16H2,1-3H3 |
| InChIKey | WMKZFOYUCVMAFT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 48.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |