C11H15N5O2 — CID 79106780
1-methyl-4-nitro-3-propyl-N-pyrrol-1-ylpyrazol-5-amine (PubChem CID 79106780) has the molecular formula C11H15N5O2 and a molecular weight of 249.27 g/mol. Its IUPAC name is 1-methyl-4-nitro-3-propyl-N-pyrrol-1-ylpyrazol-5-amine.
| Compound Name | 1-methyl-4-nitro-3-propyl-N-pyrrol-1-ylpyrazol-5-amine |
|---|---|
| PubChem CID | 79106780 |
| Molecular Formula | C11H15N5O2 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | 1-methyl-4-nitro-3-propyl-N-pyrrol-1-ylpyrazol-5-amine |
| SMILES | CCCc1nn(C)c(Nn2cccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15N5O2/c1-3-6-9-10(16(17)18)11(14(2)12-9)13-15-7-4-5-8-15/h4-5,7-8,13H,3,6H2,1-2H3 |
| InChIKey | UWWYREJKJQQUSO-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|