About 1-[1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-2-yl]ethanone
1-[1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-2-yl]ethanone (PubChem CID 79107443) has the molecular formula C14H18ClN3O
and a molecular weight of 279.77 g/mol. Its IUPAC name is 1-[1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-2-yl]ethanone.
Molecular Properties
| Compound Name | 1-[1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-2-yl]ethanone |
| PubChem CID | 79107443 |
| Molecular Formula | C14H18ClN3O |
| Molecular Weight | 279.77 g/mol |
| Exact Mass | 279.11 |
| IUPAC Name | 1-[1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-2-yl]ethanone |
| SMILES | CCc1nn(CC)c(Cn2cccc2C(C)=O)c1Cl |
| InChI | InChI=1S/C14H18ClN3O/c1-4-11-14(15)13(18(5-2)16-11)9-17-8-6-7-12(17)10(3)19/h6-8H,4-5,9H2,1-3H3 |
| InChIKey | RALVYIJHUHIKMP-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 39.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.77 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-2-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-2-yl]ethanone?
The IUPAC name of 1-[1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-2-yl]ethanone (CID 79107443) is 1-[1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-2-yl]ethanone.
What is the SMILES notation for 1-[1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-2-yl]ethanone?
The canonical SMILES for 1-[1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-2-yl]ethanone is CCc1nn(CC)c(Cn2cccc2C(C)=O)c1Cl.
What is the InChIKey of 1-[1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-2-yl]ethanone?
The InChIKey is RALVYIJHUHIKMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClN3O/c1-4-11-14(15)13(18(5-2)16-11)9-17-8-6-7-12(17)10(3)19/h6-8H,4-5,9H2,1-3H3.
What are the key properties of 1-[1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-2-yl]ethanone?
1-[1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-2-yl]ethanone has a molecular weight of 279.77 g/mol, XLogP of 3.17, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[(4-chloro-1,3-diethylpyrazol-5-yl)methyl]pyrrol-2-yl]ethanone is sourced from PubChem (CID 79107443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).