C13H24N2O2 — CID 79107966
2-[2-[3-[1-(methylamino)butyl]pyrrol-1-yl]ethoxy]ethanol (PubChem CID 79107966) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 2-[2-[3-[1-(methylamino)butyl]pyrrol-1-yl]ethoxy]ethanol.
| Compound Name | 2-[2-[3-[1-(methylamino)butyl]pyrrol-1-yl]ethoxy]ethanol |
|---|---|
| PubChem CID | 79107966 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | 2-[2-[3-[1-(methylamino)butyl]pyrrol-1-yl]ethoxy]ethanol |
| SMILES | CCCC(NC)c1ccn(CCOCCO)c1 |
| InChI | InChI=1S/C13H24N2O2/c1-3-4-13(14-2)12-5-6-15(11-12)7-9-17-10-8-16/h5-6,11,13-14,16H,3-4,7-10H2,1-2H3 |
| InChIKey | KMLJTHZNJOYDEZ-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 46.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|