C15H25F3N2O — CID 79108071
N-propyl-1-[1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrol-3-yl]butan-1-amine (PubChem CID 79108071) has the molecular formula C15H25F3N2O and a molecular weight of 306.37 g/mol. Its IUPAC name is N-propyl-1-[1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrol-3-yl]butan-1-amine.
| Compound Name | N-propyl-1-[1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrol-3-yl]butan-1-amine |
|---|---|
| PubChem CID | 79108071 |
| Molecular Formula | C15H25F3N2O |
| Molecular Weight | 306.37 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | N-propyl-1-[1-[2-(2,2,2-trifluoroethoxy)ethyl]pyrrol-3-yl]butan-1-amine |
| SMILES | CCCNC(CCC)c1ccn(CCOCC(F)(F)F)c1 |
| InChI | InChI=1S/C15H25F3N2O/c1-3-5-14(19-7-4-2)13-6-8-20(11-13)9-10-21-12-15(16,17)18/h6,8,11,14,19H,3-5,7,9-10,12H2,1-2H3 |
| InChIKey | UYUDYZRSUMQYLN-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 26.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.37 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|