C16H20FN3O — CID 79109479
N-(2-fluorophenyl)-2-[3-[1-(methylamino)propyl]pyrrol-1-yl]acetamide (PubChem CID 79109479) has the molecular formula C16H20FN3O and a molecular weight of 289.35 g/mol. Its IUPAC name is N-(2-fluorophenyl)-2-[3-[1-(methylamino)propyl]pyrrol-1-yl]acetamide.
| Compound Name | N-(2-fluorophenyl)-2-[3-[1-(methylamino)propyl]pyrrol-1-yl]acetamide |
|---|---|
| PubChem CID | 79109479 |
| Molecular Formula | C16H20FN3O |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.16 |
| IUPAC Name | N-(2-fluorophenyl)-2-[3-[1-(methylamino)propyl]pyrrol-1-yl]acetamide |
| SMILES | CCC(NC)c1ccn(CC(=O)Nc2ccccc2F)c1 |
| InChI | InChI=1S/C16H20FN3O/c1-3-14(18-2)12-8-9-20(10-12)11-16(21)19-15-7-5-4-6-13(15)17/h4-10,14,18H,3,11H2,1-2H3,(H,19,21) |
| InChIKey | RORIUKVHLFGJPK-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 46.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |