C18H24N4O2S — CID 7911158
ethyl 1-[[5-(4-methylphenyl)-3-sulfanylidene-1H-1,2,4-triazol-2-yl]methyl]piperidine-4-carboxylate (PubChem CID 7911158) has the molecular formula C18H24N4O2S and a molecular weight of 360.48 g/mol. Its IUPAC name is ethyl 1-[[5-(4-methylphenyl)-3-sulfanylidene-1H-1,2,4-triazol-2-yl]methyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[[5-(4-methylphenyl)-3-sulfanylidene-1H-1,2,4-triazol-2-yl]methyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 7911158 |
| Molecular Formula | C18H24N4O2S |
| Molecular Weight | 360.48 g/mol |
| Exact Mass | 360.16 |
| IUPAC Name | ethyl 1-[[5-(4-methylphenyl)-3-sulfanylidene-1H-1,2,4-triazol-2-yl]methyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(Cn2[nH]c(-c3ccc(C)cc3)nc2=S)CC1 |
| InChI | InChI=1S/C18H24N4O2S/c1-3-24-17(23)15-8-10-21(11-9-15)12-22-18(25)19-16(20-22)14-6-4-13(2)5-7-14/h4-7,15H,3,8-12H2,1-2H3,(H,19,20,25) |
| InChIKey | UCIRQENSVKJTTK-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 63.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.48 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|