C14H27F3N2O — CID 79111957
4-N-propyl-4-N-[3-(2,2,2-trifluoroethoxy)propyl]cyclohexane-1,4-diamine (PubChem CID 79111957) has the molecular formula C14H27F3N2O and a molecular weight of 296.38 g/mol. Its IUPAC name is 4-N-propyl-4-N-[3-(2,2,2-trifluoroethoxy)propyl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-propyl-4-N-[3-(2,2,2-trifluoroethoxy)propyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 79111957 |
| Molecular Formula | C14H27F3N2O |
| Molecular Weight | 296.38 g/mol |
| Exact Mass | 296.21 |
| IUPAC Name | 4-N-propyl-4-N-[3-(2,2,2-trifluoroethoxy)propyl]cyclohexane-1,4-diamine |
| SMILES | CCCN(CCCOCC(F)(F)F)C1CCC(N)CC1 |
| InChI | InChI=1S/C14H27F3N2O/c1-2-8-19(13-6-4-12(18)5-7-13)9-3-10-20-11-14(15,16)17/h12-13H,2-11,18H2,1H3 |
| InChIKey | JXIHMLZQHILUNP-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|