C13H25F3N2O — CID 79112101
4-N-propyl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexane-1,4-diamine (PubChem CID 79112101) has the molecular formula C13H25F3N2O and a molecular weight of 282.35 g/mol. Its IUPAC name is 4-N-propyl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexane-1,4-diamine.
| Compound Name | 4-N-propyl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexane-1,4-diamine |
|---|---|
| PubChem CID | 79112101 |
| Molecular Formula | C13H25F3N2O |
| Molecular Weight | 282.35 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 4-N-propyl-4-N-[2-(2,2,2-trifluoroethoxy)ethyl]cyclohexane-1,4-diamine |
| SMILES | CCCN(CCOCC(F)(F)F)C1CCC(N)CC1 |
| InChI | InChI=1S/C13H25F3N2O/c1-2-7-18(8-9-19-10-13(14,15)16)12-5-3-11(17)4-6-12/h11-12H,2-10,17H2,1H3 |
| InChIKey | ZLUPBGSZYYCKBH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 38.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.35 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|