About 5-bromo-1-(2,2-difluoroethyl)pyrrole-3-carboxylic acid
5-bromo-1-(2,2-difluoroethyl)pyrrole-3-carboxylic acid (PubChem CID 79112629) has the molecular formula C7H6BrF2NO2
and a molecular weight of 254.03 g/mol. Its IUPAC name is 5-bromo-1-(2,2-difluoroethyl)pyrrole-3-carboxylic acid.
Molecular Properties
| Compound Name | 5-bromo-1-(2,2-difluoroethyl)pyrrole-3-carboxylic acid |
| PubChem CID | 79112629 |
| Molecular Formula | C7H6BrF2NO2 |
| Molecular Weight | 254.03 g/mol |
| Exact Mass | 252.95 |
| IUPAC Name | 5-bromo-1-(2,2-difluoroethyl)pyrrole-3-carboxylic acid |
| SMILES | O=C(O)c1cc(Br)n(CC(F)F)c1 |
| InChI | InChI=1S/C7H6BrF2NO2/c8-5-1-4(7(12)13)2-11(5)3-6(9)10/h1-2,6H,3H2,(H,12,13) |
| InChIKey | QOAYDVPNMQEYGR-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 42.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.03 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-bromo-1-(2,2-difluoroethyl)pyrrole-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-bromo-1-(2,2-difluoroethyl)pyrrole-3-carboxylic acid?
The IUPAC name of 5-bromo-1-(2,2-difluoroethyl)pyrrole-3-carboxylic acid (CID 79112629) is 5-bromo-1-(2,2-difluoroethyl)pyrrole-3-carboxylic acid.
What is the SMILES notation for 5-bromo-1-(2,2-difluoroethyl)pyrrole-3-carboxylic acid?
The canonical SMILES for 5-bromo-1-(2,2-difluoroethyl)pyrrole-3-carboxylic acid is O=C(O)c1cc(Br)n(CC(F)F)c1.
What is the InChIKey of 5-bromo-1-(2,2-difluoroethyl)pyrrole-3-carboxylic acid?
The InChIKey is QOAYDVPNMQEYGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6BrF2NO2/c8-5-1-4(7(12)13)2-11(5)3-6(9)10/h1-2,6H,3H2,(H,12,13).
What are the key properties of 5-bromo-1-(2,2-difluoroethyl)pyrrole-3-carboxylic acid?
5-bromo-1-(2,2-difluoroethyl)pyrrole-3-carboxylic acid has a molecular weight of 254.03 g/mol, XLogP of 2.21, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-bromo-1-(2,2-difluoroethyl)pyrrole-3-carboxylic acid is sourced from PubChem (CID 79112629), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).