C13H19ClN2O — CID 79114404
N-[(5-chloro-6-pent-4-enoxy-3-pyridinyl)methyl]ethanamine (PubChem CID 79114404) has the molecular formula C13H19ClN2O and a molecular weight of 254.76 g/mol. Its IUPAC name is N-[(5-chloro-6-pent-4-enoxy-3-pyridinyl)methyl]ethanamine.
| Compound Name | N-[(5-chloro-6-pent-4-enoxy-3-pyridinyl)methyl]ethanamine |
|---|---|
| PubChem CID | 79114404 |
| Molecular Formula | C13H19ClN2O |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | N-[(5-chloro-6-pent-4-enoxy-3-pyridinyl)methyl]ethanamine |
| SMILES | C=CCCCOc1ncc(CNCC)cc1Cl |
| InChI | InChI=1S/C13H19ClN2O/c1-3-5-6-7-17-13-12(14)8-11(10-16-13)9-15-4-2/h3,8,10,15H,1,4-7,9H2,2H3 |
| InChIKey | NQKDTBGSBSWQII-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|