C13H22N4O3S — CID 79114557
4-[(4-aminocyclohexyl)sulfamoyl]-N,1-dimethylpyrrole-2-carboxamide (PubChem CID 79114557) has the molecular formula C13H22N4O3S and a molecular weight of 314.41 g/mol. Its IUPAC name is 4-[(4-aminocyclohexyl)sulfamoyl]-N,1-dimethylpyrrole-2-carboxamide.
| Compound Name | 4-[(4-aminocyclohexyl)sulfamoyl]-N,1-dimethylpyrrole-2-carboxamide |
|---|---|
| PubChem CID | 79114557 |
| Molecular Formula | C13H22N4O3S |
| Molecular Weight | 314.41 g/mol |
| Exact Mass | 314.14 |
| IUPAC Name | 4-[(4-aminocyclohexyl)sulfamoyl]-N,1-dimethylpyrrole-2-carboxamide |
| SMILES | CNC(=O)c1cc(S(=O)(=O)NC2CCC(N)CC2)cn1C |
| InChI | InChI=1S/C13H22N4O3S/c1-15-13(18)12-7-11(8-17(12)2)21(19,20)16-10-5-3-9(14)4-6-10/h7-10,16H,3-6,14H2,1-2H3,(H,15,18) |
| InChIKey | UGQMEXOOQPOREK-UHFFFAOYSA-N |
| XLogP | -0.07 |
| TPSA | 106.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.41 |
| LogP ≤ 5 | -0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |