About 2-cyclopropyl-2-(3,4-dichlorophenyl)azepane
2-cyclopropyl-2-(3,4-dichlorophenyl)azepane (PubChem CID 79116469) has the molecular formula C15H19Cl2N
and a molecular weight of 284.23 g/mol. Its IUPAC name is 2-cyclopropyl-2-(3,4-dichlorophenyl)azepane.
Molecular Properties
| Compound Name | 2-cyclopropyl-2-(3,4-dichlorophenyl)azepane |
| PubChem CID | 79116469 |
| Molecular Formula | C15H19Cl2N |
| Molecular Weight | 284.23 g/mol |
| Exact Mass | 283.09 |
| IUPAC Name | 2-cyclopropyl-2-(3,4-dichlorophenyl)azepane |
| SMILES | Clc1ccc(C2(C3CC3)CCCCCN2)cc1Cl |
| InChI | InChI=1S/C15H19Cl2N/c16-13-7-6-12(10-14(13)17)15(11-4-5-11)8-2-1-3-9-18-15/h6-7,10-11,18H,1-5,8-9H2 |
| InChIKey | LMKGMLBRSOUCRA-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.23 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-cyclopropyl-2-(3,4-dichlorophenyl)azepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopropyl-2-(3,4-dichlorophenyl)azepane?
The IUPAC name of 2-cyclopropyl-2-(3,4-dichlorophenyl)azepane (CID 79116469) is 2-cyclopropyl-2-(3,4-dichlorophenyl)azepane.
What is the SMILES notation for 2-cyclopropyl-2-(3,4-dichlorophenyl)azepane?
The canonical SMILES for 2-cyclopropyl-2-(3,4-dichlorophenyl)azepane is Clc1ccc(C2(C3CC3)CCCCCN2)cc1Cl.
What is the InChIKey of 2-cyclopropyl-2-(3,4-dichlorophenyl)azepane?
The InChIKey is LMKGMLBRSOUCRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19Cl2N/c16-13-7-6-12(10-14(13)17)15(11-4-5-11)8-2-1-3-9-18-15/h6-7,10-11,18H,1-5,8-9H2.
What are the key properties of 2-cyclopropyl-2-(3,4-dichlorophenyl)azepane?
2-cyclopropyl-2-(3,4-dichlorophenyl)azepane has a molecular weight of 284.23 g/mol, XLogP of 4.76, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopropyl-2-(3,4-dichlorophenyl)azepane is sourced from PubChem (CID 79116469), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).