C17H25BrN2O — CID 79116903
N-(4-aminocyclohexyl)-2-(4-bromophenyl)-N-propylacetamide (PubChem CID 79116903) has the molecular formula C17H25BrN2O and a molecular weight of 353.30 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-2-(4-bromophenyl)-N-propylacetamide.
| Compound Name | N-(4-aminocyclohexyl)-2-(4-bromophenyl)-N-propylacetamide |
|---|---|
| PubChem CID | 79116903 |
| Molecular Formula | C17H25BrN2O |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 352.12 |
| IUPAC Name | N-(4-aminocyclohexyl)-2-(4-bromophenyl)-N-propylacetamide |
| SMILES | CCCN(C(=O)Cc1ccc(Br)cc1)C1CCC(N)CC1 |
| InChI | InChI=1S/C17H25BrN2O/c1-2-11-20(16-9-7-15(19)8-10-16)17(21)12-13-3-5-14(18)6-4-13/h3-6,15-16H,2,7-12,19H2,1H3 |
| InChIKey | JJTPXDHAOCPUMQ-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |