About 2-phenyl-2-propylazepane
2-phenyl-2-propylazepane (PubChem CID 79117631) has the molecular formula C15H23N
and a molecular weight of 217.36 g/mol. Its IUPAC name is 2-phenyl-2-propylazepane.
Molecular Properties
| Compound Name | 2-phenyl-2-propylazepane |
| PubChem CID | 79117631 |
| Molecular Formula | C15H23N |
| Molecular Weight | 217.36 g/mol |
| Exact Mass | 217.18 |
| IUPAC Name | 2-phenyl-2-propylazepane |
| SMILES | CCCC1(c2ccccc2)CCCCCN1 |
| InChI | InChI=1S/C15H23N/c1-2-11-15(12-7-4-8-13-16-15)14-9-5-3-6-10-14/h3,5-6,9-10,16H,2,4,7-8,11-13H2,1H3 |
| InChIKey | LNQDDFVZLJYUMN-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.36 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-phenyl-2-propylazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyl-2-propylazepane?
The IUPAC name of 2-phenyl-2-propylazepane (CID 79117631) is 2-phenyl-2-propylazepane.
What is the SMILES notation for 2-phenyl-2-propylazepane?
The canonical SMILES for 2-phenyl-2-propylazepane is CCCC1(c2ccccc2)CCCCCN1.
What is the InChIKey of 2-phenyl-2-propylazepane?
The InChIKey is LNQDDFVZLJYUMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N/c1-2-11-15(12-7-4-8-13-16-15)14-9-5-3-6-10-14/h3,5-6,9-10,16H,2,4,7-8,11-13H2,1H3.
What are the key properties of 2-phenyl-2-propylazepane?
2-phenyl-2-propylazepane has a molecular weight of 217.36 g/mol, XLogP of 3.85, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyl-2-propylazepane is sourced from PubChem (CID 79117631), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).