About 2-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]-N,N-diethylpropanamide
2-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]-N,N-diethylpropanamide (PubChem CID 79118803) has the molecular formula C16H30N2O3
and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]-N,N-diethylpropanamide.
Molecular Properties
| Compound Name | 2-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]-N,N-diethylpropanamide |
| PubChem CID | 79118803 |
| Molecular Formula | C16H30N2O3 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | 2-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)C(C)N(C)C1CCC2(CC1)OCCO2 |
| InChI | InChI=1S/C16H30N2O3/c1-5-18(6-2)15(19)13(3)17(4)14-7-9-16(10-8-14)20-11-12-21-16/h13-14H,5-12H2,1-4H3 |
| InChIKey | BXNNGBDQAVZCSK-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]-N,N-diethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]-N,N-diethylpropanamide?
The IUPAC name of 2-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]-N,N-diethylpropanamide (CID 79118803) is 2-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]-N,N-diethylpropanamide.
What is the SMILES notation for 2-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]-N,N-diethylpropanamide?
The canonical SMILES for 2-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]-N,N-diethylpropanamide is CCN(CC)C(=O)C(C)N(C)C1CCC2(CC1)OCCO2.
What is the InChIKey of 2-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]-N,N-diethylpropanamide?
The InChIKey is BXNNGBDQAVZCSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H30N2O3/c1-5-18(6-2)15(19)13(3)17(4)14-7-9-16(10-8-14)20-11-12-21-16/h13-14H,5-12H2,1-4H3.
What are the key properties of 2-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]-N,N-diethylpropanamide?
2-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]-N,N-diethylpropanamide has a molecular weight of 298.43 g/mol, XLogP of 1.86, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]-N,N-diethylpropanamide is sourced from PubChem (CID 79118803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).