About 1-N,4-N-dimethyl-4-N-(1-phenyltetrazol-5-yl)cyclohexane-1,4-diamine
1-N,4-N-dimethyl-4-N-(1-phenyltetrazol-5-yl)cyclohexane-1,4-diamine (PubChem CID 79118869) has the molecular formula C15H22N6
and a molecular weight of 286.38 g/mol. Its IUPAC name is 1-N,4-N-dimethyl-4-N-(1-phenyltetrazol-5-yl)cyclohexane-1,4-diamine.
Molecular Properties
| Compound Name | 1-N,4-N-dimethyl-4-N-(1-phenyltetrazol-5-yl)cyclohexane-1,4-diamine |
| PubChem CID | 79118869 |
| Molecular Formula | C15H22N6 |
| Molecular Weight | 286.38 g/mol |
| Exact Mass | 286.19 |
| IUPAC Name | 1-N,4-N-dimethyl-4-N-(1-phenyltetrazol-5-yl)cyclohexane-1,4-diamine |
| SMILES | CNC1CCC(N(C)c2nnnn2-c2ccccc2)CC1 |
| InChI | InChI=1S/C15H22N6/c1-16-12-8-10-13(11-9-12)20(2)15-17-18-19-21(15)14-6-4-3-5-7-14/h3-7,12-13,16H,8-11H2,1-2H3 |
| InChIKey | XEGYGNJNXBRMPQ-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.38 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-N,4-N-dimethyl-4-N-(1-phenyltetrazol-5-yl)cyclohexane-1,4-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-N,4-N-dimethyl-4-N-(1-phenyltetrazol-5-yl)cyclohexane-1,4-diamine?
The IUPAC name of 1-N,4-N-dimethyl-4-N-(1-phenyltetrazol-5-yl)cyclohexane-1,4-diamine (CID 79118869) is 1-N,4-N-dimethyl-4-N-(1-phenyltetrazol-5-yl)cyclohexane-1,4-diamine.
What is the SMILES notation for 1-N,4-N-dimethyl-4-N-(1-phenyltetrazol-5-yl)cyclohexane-1,4-diamine?
The canonical SMILES for 1-N,4-N-dimethyl-4-N-(1-phenyltetrazol-5-yl)cyclohexane-1,4-diamine is CNC1CCC(N(C)c2nnnn2-c2ccccc2)CC1.
What is the InChIKey of 1-N,4-N-dimethyl-4-N-(1-phenyltetrazol-5-yl)cyclohexane-1,4-diamine?
The InChIKey is XEGYGNJNXBRMPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22N6/c1-16-12-8-10-13(11-9-12)20(2)15-17-18-19-21(15)14-6-4-3-5-7-14/h3-7,12-13,16H,8-11H2,1-2H3.
What are the key properties of 1-N,4-N-dimethyl-4-N-(1-phenyltetrazol-5-yl)cyclohexane-1,4-diamine?
1-N,4-N-dimethyl-4-N-(1-phenyltetrazol-5-yl)cyclohexane-1,4-diamine has a molecular weight of 286.38 g/mol, XLogP of 1.63, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-N,4-N-dimethyl-4-N-(1-phenyltetrazol-5-yl)cyclohexane-1,4-diamine is sourced from PubChem (CID 79118869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).