About 3-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]azepan-2-one
3-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]azepan-2-one (PubChem CID 79120079) has the molecular formula C15H26N2O3
and a molecular weight of 282.38 g/mol. Its IUPAC name is 3-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]azepan-2-one.
Molecular Properties
| Compound Name | 3-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]azepan-2-one |
| PubChem CID | 79120079 |
| Molecular Formula | C15H26N2O3 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.19 |
| IUPAC Name | 3-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]azepan-2-one |
| SMILES | CN(C1CCC2(CC1)OCCO2)C1CCCCNC1=O |
| InChI | InChI=1S/C15H26N2O3/c1-17(13-4-2-3-9-16-14(13)18)12-5-7-15(8-6-12)19-10-11-20-15/h12-13H,2-11H2,1H3,(H,16,18) |
| InChIKey | WVLCLFSNXHDUAG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]azepan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]azepan-2-one?
The IUPAC name of 3-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]azepan-2-one (CID 79120079) is 3-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]azepan-2-one.
What is the SMILES notation for 3-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]azepan-2-one?
The canonical SMILES for 3-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]azepan-2-one is CN(C1CCC2(CC1)OCCO2)C1CCCCNC1=O.
What is the InChIKey of 3-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]azepan-2-one?
The InChIKey is WVLCLFSNXHDUAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H26N2O3/c1-17(13-4-2-3-9-16-14(13)18)12-5-7-15(8-6-12)19-10-11-20-15/h12-13H,2-11H2,1H3,(H,16,18).
What are the key properties of 3-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]azepan-2-one?
3-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]azepan-2-one has a molecular weight of 282.38 g/mol, XLogP of 1.27, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[1,4-dioxaspiro[4.5]decan-8-yl(methyl)amino]azepan-2-one is sourced from PubChem (CID 79120079), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).