About 4-[methyl(3,3,3-trifluoropropyl)amino]cyclohexan-1-one
4-[methyl(3,3,3-trifluoropropyl)amino]cyclohexan-1-one (PubChem CID 79120169) has the molecular formula C10H16F3NO
and a molecular weight of 223.24 g/mol. Its IUPAC name is 4-[methyl(3,3,3-trifluoropropyl)amino]cyclohexan-1-one.
Molecular Properties
| Compound Name | 4-[methyl(3,3,3-trifluoropropyl)amino]cyclohexan-1-one |
| PubChem CID | 79120169 |
| Molecular Formula | C10H16F3NO |
| Molecular Weight | 223.24 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | 4-[methyl(3,3,3-trifluoropropyl)amino]cyclohexan-1-one |
| SMILES | CN(CCC(F)(F)F)C1CCC(=O)CC1 |
| InChI | InChI=1S/C10H16F3NO/c1-14(7-6-10(11,12)13)8-2-4-9(15)5-3-8/h8H,2-7H2,1H3 |
| InChIKey | UABNCGCTVMRURM-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.24 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[methyl(3,3,3-trifluoropropyl)amino]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[methyl(3,3,3-trifluoropropyl)amino]cyclohexan-1-one?
The IUPAC name of 4-[methyl(3,3,3-trifluoropropyl)amino]cyclohexan-1-one (CID 79120169) is 4-[methyl(3,3,3-trifluoropropyl)amino]cyclohexan-1-one.
What is the SMILES notation for 4-[methyl(3,3,3-trifluoropropyl)amino]cyclohexan-1-one?
The canonical SMILES for 4-[methyl(3,3,3-trifluoropropyl)amino]cyclohexan-1-one is CN(CCC(F)(F)F)C1CCC(=O)CC1.
What is the InChIKey of 4-[methyl(3,3,3-trifluoropropyl)amino]cyclohexan-1-one?
The InChIKey is UABNCGCTVMRURM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16F3NO/c1-14(7-6-10(11,12)13)8-2-4-9(15)5-3-8/h8H,2-7H2,1H3.
What are the key properties of 4-[methyl(3,3,3-trifluoropropyl)amino]cyclohexan-1-one?
4-[methyl(3,3,3-trifluoropropyl)amino]cyclohexan-1-one has a molecular weight of 223.24 g/mol, XLogP of 2.38, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[methyl(3,3,3-trifluoropropyl)amino]cyclohexan-1-one is sourced from PubChem (CID 79120169), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).