C12H17NOS — CID 79120186
4-[methyl(thiophen-2-ylmethyl)amino]cyclohexan-1-one (PubChem CID 79120186) has the molecular formula C12H17NOS and a molecular weight of 223.34 g/mol. Its IUPAC name is 4-[methyl(thiophen-2-ylmethyl)amino]cyclohexan-1-one.
| Compound Name | 4-[methyl(thiophen-2-ylmethyl)amino]cyclohexan-1-one |
|---|---|
| PubChem CID | 79120186 |
| Molecular Formula | C12H17NOS |
| Molecular Weight | 223.34 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 4-[methyl(thiophen-2-ylmethyl)amino]cyclohexan-1-one |
| SMILES | CN(Cc1cccs1)C1CCC(=O)CC1 |
| InChI | InChI=1S/C12H17NOS/c1-13(9-12-3-2-8-15-12)10-4-6-11(14)7-5-10/h2-3,8,10H,4-7,9H2,1H3 |
| InChIKey | PDCBQZMGSLNKOA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.34 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |