About 4-[methyl(2,2,2-trifluoroethyl)amino]cyclohexan-1-one
4-[methyl(2,2,2-trifluoroethyl)amino]cyclohexan-1-one (PubChem CID 79120423) has the molecular formula C9H14F3NO
and a molecular weight of 209.21 g/mol. Its IUPAC name is 4-[methyl(2,2,2-trifluoroethyl)amino]cyclohexan-1-one.
Molecular Properties
| Compound Name | 4-[methyl(2,2,2-trifluoroethyl)amino]cyclohexan-1-one |
| PubChem CID | 79120423 |
| Molecular Formula | C9H14F3NO |
| Molecular Weight | 209.21 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 4-[methyl(2,2,2-trifluoroethyl)amino]cyclohexan-1-one |
| SMILES | CN(CC(F)(F)F)C1CCC(=O)CC1 |
| InChI | InChI=1S/C9H14F3NO/c1-13(6-9(10,11)12)7-2-4-8(14)5-3-7/h7H,2-6H2,1H3 |
| InChIKey | OHIRGQFHJQGSMV-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.21 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-[methyl(2,2,2-trifluoroethyl)amino]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[methyl(2,2,2-trifluoroethyl)amino]cyclohexan-1-one?
The IUPAC name of 4-[methyl(2,2,2-trifluoroethyl)amino]cyclohexan-1-one (CID 79120423) is 4-[methyl(2,2,2-trifluoroethyl)amino]cyclohexan-1-one.
What is the SMILES notation for 4-[methyl(2,2,2-trifluoroethyl)amino]cyclohexan-1-one?
The canonical SMILES for 4-[methyl(2,2,2-trifluoroethyl)amino]cyclohexan-1-one is CN(CC(F)(F)F)C1CCC(=O)CC1.
What is the InChIKey of 4-[methyl(2,2,2-trifluoroethyl)amino]cyclohexan-1-one?
The InChIKey is OHIRGQFHJQGSMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14F3NO/c1-13(6-9(10,11)12)7-2-4-8(14)5-3-7/h7H,2-6H2,1H3.
What are the key properties of 4-[methyl(2,2,2-trifluoroethyl)amino]cyclohexan-1-one?
4-[methyl(2,2,2-trifluoroethyl)amino]cyclohexan-1-one has a molecular weight of 209.21 g/mol, XLogP of 1.99, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[methyl(2,2,2-trifluoroethyl)amino]cyclohexan-1-one is sourced from PubChem (CID 79120423), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).